C22H26N4O3S — CID 110222191
2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-(1-pyridin-2-yl-2-thiophen-3-ylethyl)acetamide (PubChem CID 110222191) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-(1-pyridin-2-yl-2-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-(1-pyridin-2-yl-2-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 110222191 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-(1-pyridin-2-yl-2-thiophen-3-ylethyl)acetamide |
| SMILES | O=C(CC1NC(=O)N(C2CCCCC2)C1=O)NC(Cc1ccsc1)c1ccccn1 |
| InChI | InChI=1S/C22H26N4O3S/c27-20(13-19-21(28)26(22(29)25-19)16-6-2-1-3-7-16)24-18(12-15-9-11-30-14-15)17-8-4-5-10-23-17/h4-5,8-11,14,16,18-19H,1-3,6-7,12-13H2,(H,24,27)(H,25,29) |
| InChIKey | TVGBOPCRZMTJPQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|