C24H29FN2O2 — CID 92587437
1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-2-(4-propoxyphenyl)ethanone (PubChem CID 92587437) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-2-(4-propoxyphenyl)ethanone.
| Compound Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-2-(4-propoxyphenyl)ethanone |
|---|---|
| PubChem CID | 92587437 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-2-(4-propoxyphenyl)ethanone |
| SMILES | CCCOc1ccc(CC(=O)N2CCC[C@H]3NC[C@H](c4ccc(F)cc4)[C@H]32)cc1 |
| InChI | InChI=1S/C24H29FN2O2/c1-2-14-29-20-11-5-17(6-12-20)15-23(28)27-13-3-4-22-24(27)21(16-26-22)18-7-9-19(25)10-8-18/h5-12,21-22,24,26H,2-4,13-16H2,1H3/t21-,22-,24-/m1/s1 |
| InChIKey | KUVCQEPKCJHSBL-CQOQZXRMSA-N |
| XLogP | 3.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |