C21H23FN2O2 — CID 92601171
[(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methoxyphenyl)methanone (PubChem CID 92601171) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is [(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 92601171 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1CCC[C@H]2NC[C@H](c3ccc(F)cc3)[C@H]21 |
| InChI | InChI=1S/C21H23FN2O2/c1-26-19-7-3-2-5-16(19)21(25)24-12-4-6-18-20(24)17(13-23-18)14-8-10-15(22)11-9-14/h2-3,5,7-11,17-18,20,23H,4,6,12-13H2,1H3/t17-,18-,20-/m1/s1 |
| InChIKey | TVVWSULYWHGKFH-QWFCFKBJSA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |