C22H25FN2O2 — CID 92587586
[(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-ethoxyphenyl)methanone (PubChem CID 92587586) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is [(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-ethoxyphenyl)methanone.
| Compound Name | [(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 92587586 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [(3S,3aR,7aR)-3-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl]-(2-ethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C(=O)N1CCC[C@H]2NC[C@H](c3ccc(F)cc3)[C@H]21 |
| InChI | InChI=1S/C22H25FN2O2/c1-2-27-20-8-4-3-6-17(20)22(26)25-13-5-7-19-21(25)18(14-24-19)15-9-11-16(23)12-10-15/h3-4,6,8-12,18-19,21,24H,2,5,7,13-14H2,1H3/t18-,19-,21-/m1/s1 |
| InChIKey | ZLIWJBSVUQSBJB-SFHLNBCPSA-N |
| XLogP | 3.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |