C23H26FN3O2 — CID 92589264
2-ethyl-3-[[1-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-4-yl]methyl]quinazolin-4-one (PubChem CID 92589264) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-ethyl-3-[[1-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-4-yl]methyl]quinazolin-4-one.
| Compound Name | 2-ethyl-3-[[1-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-4-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 92589264 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-ethyl-3-[[1-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-4-yl]methyl]quinazolin-4-one |
| SMILES | CCc1nc2ccccc2c(=O)n1CC1(O)CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H26FN3O2/c1-2-21-25-20-6-4-3-5-19(20)22(28)27(21)16-23(29)11-13-26(14-12-23)15-17-7-9-18(24)10-8-17/h3-10,29H,2,11-16H2,1H3 |
| InChIKey | VLIPBCOOTPYXLZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |