C22H25F2N3O3S — CID 92589991
(1R)-2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-1-(1-ethylindol-3-yl)ethanol (PubChem CID 92589991) has the molecular formula C22H25F2N3O3S and a molecular weight of 449.52 g/mol. Its IUPAC name is (1R)-2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-1-(1-ethylindol-3-yl)ethanol.
| Compound Name | (1R)-2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-1-(1-ethylindol-3-yl)ethanol |
|---|---|
| PubChem CID | 92589991 |
| Molecular Formula | C22H25F2N3O3S |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (1R)-2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-1-(1-ethylindol-3-yl)ethanol |
| SMILES | CCn1cc([C@@H](O)CN2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H25F2N3O3S/c1-2-26-14-18(17-5-3-4-6-21(17)26)22(28)15-25-9-11-27(12-10-25)31(29,30)16-7-8-19(23)20(24)13-16/h3-8,13-14,22,28H,2,9-12,15H2,1H3/t22-/m0/s1 |
| InChIKey | FKIKVFVDDMLMAJ-QFIPXVFZSA-N |
| XLogP | 2.98 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |