C22H32N4O3S — CID 92603264
[(1R)-cyclohex-3-en-1-yl]-[4-(5-methylsulfonyl-2-piperidin-1-ylpyrimidin-4-yl)piperidin-1-yl]methanone (PubChem CID 92603264) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is [(1R)-cyclohex-3-en-1-yl]-[4-(5-methylsulfonyl-2-piperidin-1-ylpyrimidin-4-yl)piperidin-1-yl]methanone.
| Compound Name | [(1R)-cyclohex-3-en-1-yl]-[4-(5-methylsulfonyl-2-piperidin-1-ylpyrimidin-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92603264 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [(1R)-cyclohex-3-en-1-yl]-[4-(5-methylsulfonyl-2-piperidin-1-ylpyrimidin-4-yl)piperidin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1cnc(N2CCCCC2)nc1C1CCN(C(=O)[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C22H32N4O3S/c1-30(28,29)19-16-23-22(26-12-6-3-7-13-26)24-20(19)17-10-14-25(15-11-17)21(27)18-8-4-2-5-9-18/h2,4,16-18H,3,5-15H2,1H3/t18-/m0/s1 |
| InChIKey | MRTZPMMWAMSAFQ-SFHVURJKSA-N |
| XLogP | 2.93 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|