C17H23N3O — CID 92604271
2,3-dimethyl-N-[(3S)-1-methylpiperidin-3-yl]-1H-indole-4-carboxamide (PubChem CID 92604271) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(3S)-1-methylpiperidin-3-yl]-1H-indole-4-carboxamide.
| Compound Name | 2,3-dimethyl-N-[(3S)-1-methylpiperidin-3-yl]-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 92604271 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2,3-dimethyl-N-[(3S)-1-methylpiperidin-3-yl]-1H-indole-4-carboxamide |
| SMILES | Cc1[nH]c2cccc(C(=O)N[C@H]3CCCN(C)C3)c2c1C |
| InChI | InChI=1S/C17H23N3O/c1-11-12(2)18-15-8-4-7-14(16(11)15)17(21)19-13-6-5-9-20(3)10-13/h4,7-8,13,18H,5-6,9-10H2,1-3H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | XYNIXGMAKLFSDQ-ZDUSSCGKSA-N |
| XLogP | 2.61 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |