C24H25FN2O2 — CID 92606292
2-(3-fluorophenyl)-1-[(3R)-3-(6-methoxy-5-methylisoquinolin-3-yl)piperidin-1-yl]ethanone (PubChem CID 92606292) has the molecular formula C24H25FN2O2 and a molecular weight of 392.47 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[(3R)-3-(6-methoxy-5-methylisoquinolin-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-[(3R)-3-(6-methoxy-5-methylisoquinolin-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 92606292 |
| Molecular Formula | C24H25FN2O2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[(3R)-3-(6-methoxy-5-methylisoquinolin-3-yl)piperidin-1-yl]ethanone |
| SMILES | COc1ccc2cnc([C@@H]3CCCN(C(=O)Cc4cccc(F)c4)C3)cc2c1C |
| InChI | InChI=1S/C24H25FN2O2/c1-16-21-13-22(26-14-18(21)8-9-23(16)29-2)19-6-4-10-27(15-19)24(28)12-17-5-3-7-20(25)11-17/h3,5,7-9,11,13-14,19H,4,6,10,12,15H2,1-2H3/t19-/m1/s1 |
| InChIKey | WPWURLUXIQFSLY-LJQANCHMSA-N |
| XLogP | 4.64 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |