C21H27N3O2S — CID 92608253
(3R,3aS,9aR)-4-methyl-3-phenyl-1-pyridin-3-ylsulfonyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocine (PubChem CID 92608253) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is (3R,3aS,9aR)-4-methyl-3-phenyl-1-pyridin-3-ylsulfonyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocine.
| Compound Name | (3R,3aS,9aR)-4-methyl-3-phenyl-1-pyridin-3-ylsulfonyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocine |
|---|---|
| PubChem CID | 92608253 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (3R,3aS,9aR)-4-methyl-3-phenyl-1-pyridin-3-ylsulfonyl-3,3a,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocine |
| SMILES | CN1CCCCC[C@@H]2[C@@H]1[C@H](c1ccccc1)CN2S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C21H27N3O2S/c1-23-14-7-3-6-12-20-21(23)19(17-9-4-2-5-10-17)16-24(20)27(25,26)18-11-8-13-22-15-18/h2,4-5,8-11,13,15,19-21H,3,6-7,12,14,16H2,1H3/t19-,20+,21-/m0/s1 |
| InChIKey | DQHWZAKLLKANEV-HBMCJLEFSA-N |
| XLogP | 3.11 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |