C23H28N4O4 — CID 9260972
(5S)-3-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-5-(4-methoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 9260972) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (5S)-3-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-5-(4-methoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-5-(4-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9260972 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (5S)-3-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-5-(4-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCN(CCO)c1ccc(/C=N\N2C(=O)N[C@@](C)(c3ccc(OC)cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C23H28N4O4/c1-5-26(12-13-28)19-9-6-17(16(2)14-19)15-24-27-21(29)23(3,25-22(27)30)18-7-10-20(31-4)11-8-18/h6-11,14-15,28H,5,12-13H2,1-4H3,(H,25,30)/b24-15-/t23-/m0/s1 |
| InChIKey | PADRLIHGYHKKCW-IBNIFWCESA-N |
| XLogP | 2.62 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|