C26H27N3O3 — CID 92618507
(2R)-N-benzyl-4-(2-phenylacetyl)-2-(pyridin-2-ylmethyl)morpholine-2-carboxamide (PubChem CID 92618507) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2R)-N-benzyl-4-(2-phenylacetyl)-2-(pyridin-2-ylmethyl)morpholine-2-carboxamide.
| Compound Name | (2R)-N-benzyl-4-(2-phenylacetyl)-2-(pyridin-2-ylmethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 92618507 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (2R)-N-benzyl-4-(2-phenylacetyl)-2-(pyridin-2-ylmethyl)morpholine-2-carboxamide |
| SMILES | O=C(Cc1ccccc1)N1CCO[C@@](Cc2ccccn2)(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C26H27N3O3/c30-24(17-21-9-3-1-4-10-21)29-15-16-32-26(20-29,18-23-13-7-8-14-27-23)25(31)28-19-22-11-5-2-6-12-22/h1-14H,15-20H2,(H,28,31)/t26-/m1/s1 |
| InChIKey | BSGKOILJPBNZEO-AREMUKBSSA-N |
| XLogP | 2.78 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |