C25H29N3O2 — CID 92634273
N-[2-[(2S)-1-(2,3-dimethyl-1H-indole-4-carbonyl)piperidin-2-yl]ethyl]benzamide (PubChem CID 92634273) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[2-[(2S)-1-(2,3-dimethyl-1H-indole-4-carbonyl)piperidin-2-yl]ethyl]benzamide.
| Compound Name | N-[2-[(2S)-1-(2,3-dimethyl-1H-indole-4-carbonyl)piperidin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 92634273 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[2-[(2S)-1-(2,3-dimethyl-1H-indole-4-carbonyl)piperidin-2-yl]ethyl]benzamide |
| SMILES | Cc1[nH]c2cccc(C(=O)N3CCCC[C@H]3CCNC(=O)c3ccccc3)c2c1C |
| InChI | InChI=1S/C25H29N3O2/c1-17-18(2)27-22-13-8-12-21(23(17)22)25(30)28-16-7-6-11-20(28)14-15-26-24(29)19-9-4-3-5-10-19/h3-5,8-10,12-13,20,27H,6-7,11,14-16H2,1-2H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | MZKDXDUURATMQE-FQEVSTJZSA-N |
| XLogP | 4.60 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |