C28H25NO8 — CID 92640793
tetramethyl (10R)-6-phenyl-10,11-dihydroazepino[1,2-a]quinoline-7,8,9,10-tetracarboxylate (PubChem CID 92640793) has the molecular formula C28H25NO8 and a molecular weight of 503.51 g/mol. Its IUPAC name is tetramethyl (10R)-6-phenyl-10,11-dihydroazepino[1,2-a]quinoline-7,8,9,10-tetracarboxylate.
| Compound Name | tetramethyl (10R)-6-phenyl-10,11-dihydroazepino[1,2-a]quinoline-7,8,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 92640793 |
| Molecular Formula | C28H25NO8 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | tetramethyl (10R)-6-phenyl-10,11-dihydroazepino[1,2-a]quinoline-7,8,9,10-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H](C(=O)OC)CN2C(=C1C(=O)OC)C(c1ccccc1)=Cc1ccccc12 |
| InChI | InChI=1S/C28H25NO8/c1-34-25(30)19-15-29-20-13-9-8-12-17(20)14-18(16-10-6-5-7-11-16)24(29)23(28(33)37-4)22(27(32)36-3)21(19)26(31)35-2/h5-14,19H,15H2,1-4H3/t19-/m0/s1 |
| InChIKey | KFHAYFMDVAJFHB-IBGZPJMESA-N |
| XLogP | 2.92 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|