C21H19NO4 — CID 132557459
dimethyl 1,2-diphenyl-2H-pyridine-4,5-dicarboxylate (PubChem CID 132557459) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is dimethyl 1,2-diphenyl-2H-pyridine-4,5-dicarboxylate.
| Compound Name | dimethyl 1,2-diphenyl-2H-pyridine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 132557459 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | dimethyl 1,2-diphenyl-2H-pyridine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=CC(c2ccccc2)N(c2ccccc2)C=C1C(=O)OC |
| InChI | InChI=1S/C21H19NO4/c1-25-20(23)17-13-19(15-9-5-3-6-10-15)22(14-18(17)21(24)26-2)16-11-7-4-8-12-16/h3-14,19H,1-2H3 |
| InChIKey | HWTFTDSJLRCWRF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |