C18H27N3OS — CID 92653280
N-(3-methylphenyl)-4-[(6S)-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl]butanamide (PubChem CID 92653280) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is N-(3-methylphenyl)-4-[(6S)-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl]butanamide.
| Compound Name | N-(3-methylphenyl)-4-[(6S)-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl]butanamide |
|---|---|
| PubChem CID | 92653280 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-(3-methylphenyl)-4-[(6S)-4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl]butanamide |
| SMILES | Cc1cccc(NC(=O)CCCN2C(=S)NC(C)(C)C[C@@H]2C)c1 |
| InChI | InChI=1S/C18H27N3OS/c1-13-7-5-8-15(11-13)19-16(22)9-6-10-21-14(2)12-18(3,4)20-17(21)23/h5,7-8,11,14H,6,9-10,12H2,1-4H3,(H,19,22)(H,20,23)/t14-/m0/s1 |
| InChIKey | NCBNVPWGJLCICL-AWEZNQCLSA-N |
| XLogP | 3.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|