C20H28N2O4 — CID 92667539
ethyl (3R)-1-[2-[2-(cyclohexen-1-yl)ethylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate (PubChem CID 92667539) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[2-(cyclohexen-1-yl)ethylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[2-(cyclohexen-1-yl)ethylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 92667539 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | ethyl (3R)-1-[2-[2-(cyclohexen-1-yl)ethylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2c(NCCC3=CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C20H28N2O4/c1-2-26-20(25)15-9-6-12-22(13-15)17-16(18(23)19(17)24)21-11-10-14-7-4-3-5-8-14/h7,15,21H,2-6,8-13H2,1H3/t15-/m1/s1 |
| InChIKey | DWERYEINLNPNSM-OAHLLOKOSA-N |
| XLogP | 2.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|