C21H33N3O4 — CID 98220031
ethyl (3S)-1-[2-[3-(azepan-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate (PubChem CID 98220031) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[3-(azepan-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[3-(azepan-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98220031 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | ethyl (3S)-1-[2-[3-(azepan-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2c(NCCCN3CCCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C21H33N3O4/c1-2-28-21(27)16-9-7-14-24(15-16)18-17(19(25)20(18)26)22-10-8-13-23-11-5-3-4-6-12-23/h16,22H,2-15H2,1H3/t16-/m0/s1 |
| InChIKey | DMIHMBBFRJKIEG-INIZCTEOSA-N |
| XLogP | 1.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|