C21H34N4O4 — CID 98220050
ethyl (3R)-1-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate (PubChem CID 98220050) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98220050 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | ethyl (3R)-1-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-3,4-dioxocyclobuten-1-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2c(NCCCN3CCN(CC)CC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C21H34N4O4/c1-3-23-11-13-24(14-12-23)9-6-8-22-17-18(20(27)19(17)26)25-10-5-7-16(15-25)21(28)29-4-2/h16,22H,3-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | GGJAIPZWKNJPPS-MRXNPFEDSA-N |
| XLogP | 0.50 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|