C21H34N4O4 — CID 98220251
ethyl 4-[[2-[3-[(3S)-3-methylpiperidin-1-yl]propylamino]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate (PubChem CID 98220251) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[(3S)-3-methylpiperidin-1-yl]propylamino]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[3-[(3S)-3-methylpiperidin-1-yl]propylamino]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 98220251 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | ethyl 4-[[2-[3-[(3S)-3-methylpiperidin-1-yl]propylamino]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2c(NCCCN3CCC[C@H](C)C3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C21H34N4O4/c1-3-29-21(28)25-12-7-16(8-13-25)23-18-17(19(26)20(18)27)22-9-5-11-24-10-4-6-15(2)14-24/h15-16,22-23H,3-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | GMAPOBWEEUQDKA-HNNXBMFYSA-N |
| XLogP | 1.85 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|