C30H36N4O2 — CID 92668590
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-oxo-5-[(2,4,6-trimethylphenyl)methyl]pyridazino[4,5-b]indol-3-yl]acetamide (PubChem CID 92668590) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-oxo-5-[(2,4,6-trimethylphenyl)methyl]pyridazino[4,5-b]indol-3-yl]acetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-oxo-5-[(2,4,6-trimethylphenyl)methyl]pyridazino[4,5-b]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 92668590 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-oxo-5-[(2,4,6-trimethylphenyl)methyl]pyridazino[4,5-b]indol-3-yl]acetamide |
| SMILES | Cc1cc(C)c(Cn2c3ccccc3c3cnn(CC(=O)N[C@@H]4CCC[C@@H](C)[C@H]4C)c(=O)c32)c(C)c1 |
| InChI | InChI=1S/C30H36N4O2/c1-18-13-20(3)25(21(4)14-18)16-33-27-12-7-6-10-23(27)24-15-31-34(30(36)29(24)33)17-28(35)32-26-11-8-9-19(2)22(26)5/h6-7,10,12-15,19,22,26H,8-9,11,16-17H2,1-5H3,(H,32,35)/t19-,22-,26-/m1/s1 |
| InChIKey | JLNFUIGPMDIFPL-KCVHQNEMSA-N |
| XLogP | 5.27 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |