C25H31ClN4O2 — CID 92669044
2-[6-[(2-chlorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 92669044) has the molecular formula C25H31ClN4O2 and a molecular weight of 455.00 g/mol. Its IUPAC name is 2-[6-[(2-chlorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[6-[(2-chlorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 92669044 |
| Molecular Formula | C25H31ClN4O2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-[6-[(2-chlorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | Cc1c2cnn(CC(=O)N[C@@H]3CCC[C@H](C)[C@H]3C)c(=O)c2c(C)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H31ClN4O2/c1-15-8-7-11-22(16(15)2)28-23(31)14-30-25(32)24-18(4)29(17(3)20(24)12-27-30)13-19-9-5-6-10-21(19)26/h5-6,9-10,12,15-16,22H,7-8,11,13-14H2,1-4H3,(H,28,31)/t15-,16+,22+/m0/s1 |
| InChIKey | SXORZQPVJBNXOT-WJONJSRFSA-N |
| XLogP | 4.46 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |