C25H31FN4O2 — CID 93168294
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[6-[(4-fluorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]acetamide (PubChem CID 93168294) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[6-[(4-fluorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]acetamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[6-[(4-fluorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 93168294 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[6-[(4-fluorophenyl)methyl]-5,7-dimethyl-4-oxopyrrolo[3,4-d]pyridazin-3-yl]acetamide |
| SMILES | Cc1c2cnn(CC(=O)N[C@@H]3CCC[C@@H](C)[C@@H]3C)c(=O)c2c(C)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H31FN4O2/c1-15-6-5-7-22(16(15)2)28-23(31)14-30-25(32)24-18(4)29(17(3)21(24)12-27-30)13-19-8-10-20(26)11-9-19/h8-12,15-16,22H,5-7,13-14H2,1-4H3,(H,28,31)/t15-,16+,22-/m1/s1 |
| InChIKey | KBEZJIGBJXVAFV-ZMPRRUGASA-N |
| XLogP | 3.94 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |