C13H20NO3S2+ — CID 9267489
[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-[2-(4-methylphenyl)sulfanylethyl]azanium (PubChem CID 9267489) has the molecular formula C13H20NO3S2+ and a molecular weight of 302.44 g/mol. Its IUPAC name is [(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-[2-(4-methylphenyl)sulfanylethyl]azanium.
| Compound Name | [(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-[2-(4-methylphenyl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 9267489 |
| Molecular Formula | C13H20NO3S2+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-[2-(4-methylphenyl)sulfanylethyl]azanium |
| SMILES | Cc1ccc(SCC[NH2+][C@@H]2CS(=O)(=O)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H19NO3S2/c1-10-2-4-11(5-3-10)18-7-6-14-12-8-19(16,17)9-13(12)15/h2-5,12-15H,6-9H2,1H3/p+1/t12-,13+/m1/s1 |
| InChIKey | PRJIALPVMFQWQR-OLZOCXBDSA-O |
| XLogP | -0.19 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|