C25H24ClNO3 — CID 92681200
(2R)-N-(2-benzoyl-4-chlorophenyl)-2-(3,4-dimethylphenoxy)butanamide (PubChem CID 92681200) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is (2R)-N-(2-benzoyl-4-chlorophenyl)-2-(3,4-dimethylphenoxy)butanamide.
| Compound Name | (2R)-N-(2-benzoyl-4-chlorophenyl)-2-(3,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 92681200 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (2R)-N-(2-benzoyl-4-chlorophenyl)-2-(3,4-dimethylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc(C)c(C)c1)C(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24ClNO3/c1-4-23(30-20-12-10-16(2)17(3)14-20)25(29)27-22-13-11-19(26)15-21(22)24(28)18-8-6-5-7-9-18/h5-15,23H,4H2,1-3H3,(H,27,29)/t23-/m1/s1 |
| InChIKey | JKFMNZDOUPISGX-HSZRJFAPSA-N |
| XLogP | 5.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |