C20H25BrN2O4S2 — CID 92683691
1-[(4-bromophenyl)methylsulfonyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide (PubChem CID 92683691) has the molecular formula C20H25BrN2O4S2 and a molecular weight of 501.47 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methylsulfonyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methylsulfonyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92683691 |
| Molecular Formula | C20H25BrN2O4S2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 1-[(4-bromophenyl)methylsulfonyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1ccco1)C1CCN(S(=O)(=O)Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H25BrN2O4S2/c21-18-5-3-16(4-6-18)15-29(25,26)23-10-7-17(8-11-23)20(24)22-9-13-28-14-19-2-1-12-27-19/h1-6,12,17H,7-11,13-15H2,(H,22,24) |
| InChIKey | GHQHICLCWLKVNA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|