C15H14BrN3O2S2 — CID 92686097
5-bromo-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]thiophene-2-sulfonamide (PubChem CID 92686097) has the molecular formula C15H14BrN3O2S2 and a molecular weight of 412.33 g/mol. Its IUPAC name is 5-bromo-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 92686097 |
| Molecular Formula | C15H14BrN3O2S2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 5-bromo-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]thiophene-2-sulfonamide |
| SMILES | Cc1nccn1-c1ccc(CNS(=O)(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C15H14BrN3O2S2/c1-11-17-8-9-19(11)13-4-2-12(3-5-13)10-18-23(20,21)15-7-6-14(16)22-15/h2-9,18H,10H2,1H3 |
| InChIKey | BCVWPILVNYMRHU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |