C23H39N3O3S — CID 92687204
(3R)-N-[(1R)-1-(1-adamantyl)ethyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide (PubChem CID 92687204) has the molecular formula C23H39N3O3S and a molecular weight of 437.65 g/mol. Its IUPAC name is (3R)-N-[(1R)-1-(1-adamantyl)ethyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[(1R)-1-(1-adamantyl)ethyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92687204 |
| Molecular Formula | C23H39N3O3S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (3R)-N-[(1R)-1-(1-adamantyl)ethyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@H]1CCCN(S(=O)(=O)N2CCCCC2)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H39N3O3S/c1-17(23-13-18-10-19(14-23)12-20(11-18)15-23)24-22(27)21-6-5-9-26(16-21)30(28,29)25-7-3-2-4-8-25/h17-21H,2-16H2,1H3,(H,24,27)/t17-,18?,19?,20?,21-,23?/m1/s1 |
| InChIKey | RRTIPEWDWADICS-SPTIWXGTSA-N |
| XLogP | 3.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |