C26H25N3O6S — CID 92693533
(2E)-2-[(2,5-dimethoxyphenyl)sulfonylhydrazinylidene]-N-(4-ethylphenyl)chromene-3-carboxamide (PubChem CID 92693533) has the molecular formula C26H25N3O6S and a molecular weight of 507.57 g/mol. Its IUPAC name is (2E)-2-[(2,5-dimethoxyphenyl)sulfonylhydrazinylidene]-N-(4-ethylphenyl)chromene-3-carboxamide.
| Compound Name | (2E)-2-[(2,5-dimethoxyphenyl)sulfonylhydrazinylidene]-N-(4-ethylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 92693533 |
| Molecular Formula | C26H25N3O6S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | (2E)-2-[(2,5-dimethoxyphenyl)sulfonylhydrazinylidene]-N-(4-ethylphenyl)chromene-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2cc3ccccc3o/c2=N/NS(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C26H25N3O6S/c1-4-17-9-11-19(12-10-17)27-25(30)21-15-18-7-5-6-8-22(18)35-26(21)28-29-36(31,32)24-16-20(33-2)13-14-23(24)34-3/h5-16,29H,4H2,1-3H3,(H,27,30)/b28-26+ |
| InChIKey | UVSJIQJNSFBHOQ-BYCLXTJYSA-N |
| XLogP | 4.06 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|