C27H27F3N2O3 — CID 92698184
2-ethoxy-6-[(2S,6R)-4-(4-ethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 92698184) has the molecular formula C27H27F3N2O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-ethoxy-6-[(2S,6R)-4-(4-ethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-ethoxy-6-[(2S,6R)-4-(4-ethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 92698184 |
| Molecular Formula | C27H27F3N2O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-ethoxy-6-[(2S,6R)-4-(4-ethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | CCOc1ccc(C2=N[C@@H](c3ccc(C(F)(F)F)cc3)N[C@@H](c3cccc(OCC)c3O)C2)cc1 |
| InChI | InChI=1S/C27H27F3N2O3/c1-3-34-20-14-10-17(11-15-20)22-16-23(21-6-5-7-24(25(21)33)35-4-2)32-26(31-22)18-8-12-19(13-9-18)27(28,29)30/h5-15,23,26,32-33H,3-4,16H2,1-2H3/t23-,26-/m1/s1 |
| InChIKey | XXRZMFLQROHYLW-ZEQKJWHPSA-N |
| XLogP | 6.43 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|