C26H23ClFN3O2 — CID 92706549
(1R)-6-chloro-N-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 92706549) has the molecular formula C26H23ClFN3O2 and a molecular weight of 463.94 g/mol. Its IUPAC name is (1R)-6-chloro-N-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | (1R)-6-chloro-N-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 92706549 |
| Molecular Formula | C26H23ClFN3O2 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (1R)-6-chloro-N-[(4-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | COc1ccc([C@@H]2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H23ClFN3O2/c1-33-20-9-4-17(5-10-20)25-24-21(22-14-18(27)6-11-23(22)30-24)12-13-31(25)26(32)29-15-16-2-7-19(28)8-3-16/h2-11,14,25,30H,12-13,15H2,1H3,(H,29,32)/t25-/m1/s1 |
| InChIKey | SNBFVUIATSWHCX-RUZDIDTESA-N |
| XLogP | 5.83 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|