C15H17N3O3 — CID 92708005
(3S)-N-(1,3-benzodioxol-5-ylmethyl)-3-pyrazol-1-ylbutanamide (PubChem CID 92708005) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (3S)-N-(1,3-benzodioxol-5-ylmethyl)-3-pyrazol-1-ylbutanamide.
| Compound Name | (3S)-N-(1,3-benzodioxol-5-ylmethyl)-3-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 92708005 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3S)-N-(1,3-benzodioxol-5-ylmethyl)-3-pyrazol-1-ylbutanamide |
| SMILES | C[C@@H](CC(=O)NCc1ccc2c(c1)OCO2)n1cccn1 |
| InChI | InChI=1S/C15H17N3O3/c1-11(18-6-2-5-17-18)7-15(19)16-9-12-3-4-13-14(8-12)21-10-20-13/h2-6,8,11H,7,9-10H2,1H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | GEVXWZDGYJPSHZ-NSHDSACASA-N |
| XLogP | 1.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |