C24H33N3O — CID 92709898
(3R)-3-(3-methylphenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one (PubChem CID 92709898) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is (3R)-3-(3-methylphenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one.
| Compound Name | (3R)-3-(3-methylphenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 92709898 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (3R)-3-(3-methylphenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)-3-pyrrol-1-ylpropan-1-one |
| SMILES | Cc1cccc([C@@H](CC(=O)N2CCC(N3CCCCC3)CC2)n2cccc2)c1 |
| InChI | InChI=1S/C24H33N3O/c1-20-8-7-9-21(18-20)23(26-14-5-6-15-26)19-24(28)27-16-10-22(11-17-27)25-12-3-2-4-13-25/h5-9,14-15,18,22-23H,2-4,10-13,16-17,19H2,1H3/t23-/m1/s1 |
| InChIKey | HTRDZLTYOGLOMO-HSZRJFAPSA-N |
| XLogP | 4.25 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |