C22H36N4O4S — CID 92710633
(2R)-1-acetyl-N-[3-(diethylamino)propyl]-5-(diethylsulfamoyl)-2,3-dihydroindole-2-carboxamide (PubChem CID 92710633) has the molecular formula C22H36N4O4S and a molecular weight of 452.62 g/mol. Its IUPAC name is (2R)-1-acetyl-N-[3-(diethylamino)propyl]-5-(diethylsulfamoyl)-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2R)-1-acetyl-N-[3-(diethylamino)propyl]-5-(diethylsulfamoyl)-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 92710633 |
| Molecular Formula | C22H36N4O4S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (2R)-1-acetyl-N-[3-(diethylamino)propyl]-5-(diethylsulfamoyl)-2,3-dihydroindole-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)[C@H]1Cc2cc(S(=O)(=O)N(CC)CC)ccc2N1C(C)=O |
| InChI | InChI=1S/C22H36N4O4S/c1-6-24(7-2)14-10-13-23-22(28)21-16-18-15-19(31(29,30)25(8-3)9-4)11-12-20(18)26(21)17(5)27/h11-12,15,21H,6-10,13-14,16H2,1-5H3,(H,23,28)/t21-/m1/s1 |
| InChIKey | PVSFVZWZUJJRSL-OAQYLSRUSA-N |
| XLogP | 1.84 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|