C26H28N2OS — CID 92711555
(1S)-N-(3,5-dimethylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide (PubChem CID 92711555) has the molecular formula C26H28N2OS and a molecular weight of 416.59 g/mol. Its IUPAC name is (1S)-N-(3,5-dimethylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (1S)-N-(3,5-dimethylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 92711555 |
| Molecular Formula | C26H28N2OS |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (1S)-N-(3,5-dimethylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)N2CCc3c(sc4c3CCCC4)[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2OS/c1-17-14-18(2)16-20(15-17)27-26(29)28-13-12-22-21-10-6-7-11-23(21)30-25(22)24(28)19-8-4-3-5-9-19/h3-5,8-9,14-16,24H,6-7,10-13H2,1-2H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | RCPBDTNDZRCDOP-DEOSSOPVSA-N |
| XLogP | 6.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |