C25H25FN2OS — CID 92711608
(1R)-N-[(4-fluorophenyl)methyl]-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide (PubChem CID 92711608) has the molecular formula C25H25FN2OS and a molecular weight of 420.55 g/mol. Its IUPAC name is (1R)-N-[(4-fluorophenyl)methyl]-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (1R)-N-[(4-fluorophenyl)methyl]-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 92711608 |
| Molecular Formula | C25H25FN2OS |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (1R)-N-[(4-fluorophenyl)methyl]-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCc2c(sc3c2CCCC3)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H25FN2OS/c26-19-12-10-17(11-13-19)16-27-25(29)28-15-14-21-20-8-4-5-9-22(20)30-24(21)23(28)18-6-2-1-3-7-18/h1-3,6-7,10-13,23H,4-5,8-9,14-16H2,(H,27,29)/t23-/m1/s1 |
| InChIKey | KVDDHWQAIXEQFG-HSZRJFAPSA-N |
| XLogP | 5.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |