C25H25BrN2OS — CID 20964404
N-(4-bromo-3-methylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide (PubChem CID 20964404) has the molecular formula C25H25BrN2OS and a molecular weight of 481.46 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 20964404 |
| Molecular Formula | C25H25BrN2OS |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1-phenyl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-c]pyridine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)N2CCc3c(sc4c3CCCC4)C2c2ccccc2)ccc1Br |
| InChI | InChI=1S/C25H25BrN2OS/c1-16-15-18(11-12-21(16)26)27-25(29)28-14-13-20-19-9-5-6-10-22(19)30-24(20)23(28)17-7-3-2-4-8-17/h2-4,7-8,11-12,15,23H,5-6,9-10,13-14H2,1H3,(H,27,29) |
| InChIKey | HAEMZPQCUFDKKE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |