C18H14N4O4 — CID 92713939
(7S)-6-(furan-2-ylmethyl)-7-(4-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 92713939) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is (7S)-6-(furan-2-ylmethyl)-7-(4-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (7S)-6-(furan-2-ylmethyl)-7-(4-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 92713939 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (7S)-6-(furan-2-ylmethyl)-7-(4-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1c2cccnc2[C@@H](Nc2ccc([N+](=O)[O-])cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C18H14N4O4/c23-18-15-4-1-9-19-16(15)17(21(18)11-14-3-2-10-26-14)20-12-5-7-13(8-6-12)22(24)25/h1-10,17,20H,11H2/t17-/m0/s1 |
| InChIKey | BSSFUFHPANRCBA-KRWDZBQOSA-N |
| XLogP | 3.35 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|