C16H16N4O3S — CID 142670861
2-(4-nitroanilino)-3-propyl-2H-pyrido[3,2-e][1,3]thiazin-4-one (PubChem CID 142670861) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 2-(4-nitroanilino)-3-propyl-2H-pyrido[3,2-e][1,3]thiazin-4-one.
| Compound Name | 2-(4-nitroanilino)-3-propyl-2H-pyrido[3,2-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 142670861 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-(4-nitroanilino)-3-propyl-2H-pyrido[3,2-e][1,3]thiazin-4-one |
| SMILES | CCCN1C(=O)c2cccnc2SC1Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H16N4O3S/c1-2-10-19-15(21)13-4-3-9-17-14(13)24-16(19)18-11-5-7-12(8-6-11)20(22)23/h3-9,16,18H,2,10H2,1H3 |
| InChIKey | GXWZMDKLZJMNLH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|