C27H31N3O3S — CID 92715317
(2R)-1-[(3,4-dimethoxyphenyl)methyl]-2-[4-(dimethylamino)phenyl]-2,3,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 92715317) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is (2R)-1-[(3,4-dimethoxyphenyl)methyl]-2-[4-(dimethylamino)phenyl]-2,3,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R)-1-[(3,4-dimethoxyphenyl)methyl]-2-[4-(dimethylamino)phenyl]-2,3,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 92715317 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (2R)-1-[(3,4-dimethoxyphenyl)methyl]-2-[4-(dimethylamino)phenyl]-2,3,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(CN2c3sc4c(c3C(=O)N[C@H]2c2ccc(N(C)C)cc2)CCCC4)cc1OC |
| InChI | InChI=1S/C27H31N3O3S/c1-29(2)19-12-10-18(11-13-19)25-28-26(31)24-20-7-5-6-8-23(20)34-27(24)30(25)16-17-9-14-21(32-3)22(15-17)33-4/h9-15,25H,5-8,16H2,1-4H3,(H,28,31)/t25-/m1/s1 |
| InChIKey | HYZKWPRMTLGVII-RUZDIDTESA-N |
| XLogP | 5.16 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|