C27H24N2O4S — CID 92719846
(7R)-3-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-7-(4-methoxyphenyl)-1,6,7,8-tetrahydroquinoline-2,5-dione (PubChem CID 92719846) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is (7R)-3-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-7-(4-methoxyphenyl)-1,6,7,8-tetrahydroquinoline-2,5-dione.
| Compound Name | (7R)-3-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-7-(4-methoxyphenyl)-1,6,7,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 92719846 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (7R)-3-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-7-(4-methoxyphenyl)-1,6,7,8-tetrahydroquinoline-2,5-dione |
| SMILES | CCOc1ccc(-c2csc(-c3cc4c([nH]c3=O)C[C@@H](c3ccc(OC)cc3)CC4=O)n2)cc1 |
| InChI | InChI=1S/C27H24N2O4S/c1-3-33-20-10-6-17(7-11-20)24-15-34-27(29-24)22-14-21-23(28-26(22)31)12-18(13-25(21)30)16-4-8-19(32-2)9-5-16/h4-11,14-15,18H,3,12-13H2,1-2H3,(H,28,31)/t18-/m1/s1 |
| InChIKey | IHQWRCCEMHLGNW-GOSISDBHSA-N |
| XLogP | 5.49 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |