C23H25N7O4 — CID 92721109
(9R)-9-(5-tert-butyl-2-methyl-4-nitropyrazol-3-yl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 92721109) has the molecular formula C23H25N7O4 and a molecular weight of 463.50 g/mol. Its IUPAC name is (9R)-9-(5-tert-butyl-2-methyl-4-nitropyrazol-3-yl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | (9R)-9-(5-tert-butyl-2-methyl-4-nitropyrazol-3-yl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 92721109 |
| Molecular Formula | C23H25N7O4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (9R)-9-(5-tert-butyl-2-methyl-4-nitropyrazol-3-yl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | Cn1nc(C(C)(C)C)c([N+](=O)[O-])c1[C@@H]1Nc2ccccc2-n2cc3c(=O)n(C)c(=O)n(C)c3c21 |
| InChI | InChI=1S/C23H25N7O4/c1-23(2,3)20-19(30(33)34)17(28(6)25-20)15-18-16-12(21(31)27(5)22(32)26(16)4)11-29(18)14-10-8-7-9-13(14)24-15/h7-11,15,24H,1-6H3/t15-/m0/s1 |
| InChIKey | IKIPEIXCXCRNAW-HNNXBMFYSA-N |
| XLogP | 2.48 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|