C23H22N4O3 — CID 92727458
(9R)-9-(2-ethoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 92727458) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is (9R)-9-(2-ethoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | (9R)-9-(2-ethoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 92727458 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (9R)-9-(2-ethoxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | CCOc1ccccc1[C@H]1Nc2ccccc2-n2cc3c(=O)n(C)c(=O)n(C)c3c21 |
| InChI | InChI=1S/C23H22N4O3/c1-4-30-18-12-8-5-9-14(18)19-21-20-15(22(28)26(3)23(29)25(20)2)13-27(21)17-11-7-6-10-16(17)24-19/h5-13,19,24H,4H2,1-3H3/t19-/m1/s1 |
| InChIKey | KWPWGCPHBIRFRH-LJQANCHMSA-N |
| XLogP | 2.94 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |