C30H29N3O2 — CID 92723976
(4R)-4-(4-methoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide (PubChem CID 92723976) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (4R)-4-(4-methoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide.
| Compound Name | (4R)-4-(4-methoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 92723976 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (4R)-4-(4-methoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
| SMILES | COc1ccc([C@@H]2c3cccn3-c3ccccc3CN2C(=O)Nc2cccc3c2CCCC3)cc1 |
| InChI | InChI=1S/C30H29N3O2/c1-35-24-17-15-22(16-18-24)29-28-14-7-19-32(28)27-13-5-3-9-23(27)20-33(29)30(34)31-26-12-6-10-21-8-2-4-11-25(21)26/h3,5-7,9-10,12-19,29H,2,4,8,11,20H2,1H3,(H,31,34)/t29-/m1/s1 |
| InChIKey | RIRLTMIVZCXNPS-GDLZYMKVSA-N |
| XLogP | 6.50 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |