C29H25F2N3O — CID 92724023
(4S)-4-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide (PubChem CID 92724023) has the molecular formula C29H25F2N3O and a molecular weight of 469.54 g/mol. Its IUPAC name is (4S)-4-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide.
| Compound Name | (4S)-4-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 92724023 |
| Molecular Formula | C29H25F2N3O |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (4S)-4-(3,5-difluorophenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
| SMILES | O=C(Nc1cccc2c1CCCC2)N1Cc2ccccc2-n2cccc2[C@@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C29H25F2N3O/c30-22-15-21(16-23(31)17-22)28-27-13-6-14-33(27)26-12-4-2-8-20(26)18-34(28)29(35)32-25-11-5-9-19-7-1-3-10-24(19)25/h2,4-6,8-9,11-17,28H,1,3,7,10,18H2,(H,32,35)/t28-/m0/s1 |
| InChIKey | UJBONFROGHPADG-NDEPHWFRSA-N |
| XLogP | 6.77 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |