C31H31N3O3 — CID 92724038
(4R)-4-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide (PubChem CID 92724038) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is (4R)-4-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide.
| Compound Name | (4R)-4-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 92724038 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (4R)-4-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
| SMILES | COc1ccc([C@@H]2c3cccn3-c3ccccc3CN2C(=O)Nc2cccc3c2CCCC3)cc1OC |
| InChI | InChI=1S/C31H31N3O3/c1-36-28-17-16-22(19-29(28)37-2)30-27-15-8-18-33(27)26-14-6-4-10-23(26)20-34(30)31(35)32-25-13-7-11-21-9-3-5-12-24(21)25/h4,6-8,10-11,13-19,30H,3,5,9,12,20H2,1-2H3,(H,32,35)/t30-/m1/s1 |
| InChIKey | OTECXBNPZUVTFW-SSEXGKCCSA-N |
| XLogP | 6.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |