C24H28N4O3 — CID 92726229
(6aR)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one (PubChem CID 92726229) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (6aR)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one.
| Compound Name | (6aR)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
|---|---|
| PubChem CID | 92726229 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (6aR)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc4c(c3)NC(=O)[C@H]3CCCCN43)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-31-19-8-6-18(7-9-19)26-12-14-27(15-13-26)24(30)17-5-10-21-20(16-17)25-23(29)22-4-2-3-11-28(21)22/h5-10,16,22H,2-4,11-15H2,1H3,(H,25,29)/t22-/m1/s1 |
| InChIKey | KAUJLENUTVAQEC-JOCHJYFZSA-N |
| XLogP | 2.97 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|