C18H23N3O6 — CID 9273624
3-methyl-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)-1,2-oxazole-4-carbohydrazide (PubChem CID 9273624) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-methyl-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9273624 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-methyl-5-propan-2-yl-N'-(3,4,5-trimethoxybenzoyl)-1,2-oxazole-4-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2c(C)noc2C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C18H23N3O6/c1-9(2)15-14(10(3)21-27-15)18(23)20-19-17(22)11-7-12(24-4)16(26-6)13(8-11)25-5/h7-9H,1-6H3,(H,19,22)(H,20,23) |
| InChIKey | FNGDTHWNUDJDEI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|