C25H29N3O2 — CID 92748440
(4S)-4-(4-ethylphenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide (PubChem CID 92748440) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (4S)-4-(4-ethylphenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide.
| Compound Name | (4S)-4-(4-ethylphenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 92748440 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (4S)-4-(4-ethylphenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
| SMILES | CCc1ccc([C@H]2c3cccn3-c3ccccc3CN2C(=O)NCCCOC)cc1 |
| InChI | InChI=1S/C25H29N3O2/c1-3-19-11-13-20(14-12-19)24-23-10-6-16-27(23)22-9-5-4-8-21(22)18-28(24)25(29)26-15-7-17-30-2/h4-6,8-14,16,24H,3,7,15,17-18H2,1-2H3,(H,26,29)/t24-/m0/s1 |
| InChIKey | CBNBOUGHDRTJIU-DEOSSOPVSA-N |
| XLogP | 4.69 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|