C23H24ClN3O2 — CID 92748596
(4S)-4-(3-chlorophenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide (PubChem CID 92748596) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is (4S)-4-(3-chlorophenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide.
| Compound Name | (4S)-4-(3-chlorophenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 92748596 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (4S)-4-(3-chlorophenyl)-N-(3-methoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
| SMILES | COCCCNC(=O)N1Cc2ccccc2-n2cccc2[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24ClN3O2/c1-29-14-6-12-25-23(28)27-16-18-7-2-3-10-20(18)26-13-5-11-21(26)22(27)17-8-4-9-19(24)15-17/h2-5,7-11,13,15,22H,6,12,14,16H2,1H3,(H,25,28)/t22-/m0/s1 |
| InChIKey | YCZKZBWIGFAKCB-QFIPXVFZSA-N |
| XLogP | 4.78 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|